C20H14ClN7 — CID 155809030
2-N-(2-chlorophenyl)-6-N-quinolin-3-yl-7H-purine-2,6-diamine (PubChem CID 155809030) has the molecular formula C20H14ClN7 and a molecular weight of 387.83 g/mol. Its IUPAC name is 2-N-(2-chlorophenyl)-6-N-quinolin-3-yl-7H-purine-2,6-diamine.
| Compound Name | 2-N-(2-chlorophenyl)-6-N-quinolin-3-yl-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 155809030 |
| Molecular Formula | C20H14ClN7 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-N-(2-chlorophenyl)-6-N-quinolin-3-yl-7H-purine-2,6-diamine |
| SMILES | Clc1ccccc1Nc1nc(Nc2cnc3ccccc3c2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C20H14ClN7/c21-14-6-2-4-8-16(14)26-20-27-18-17(23-11-24-18)19(28-20)25-13-9-12-5-1-3-7-15(12)22-10-13/h1-11H,(H3,23,24,25,26,27,28) |
| InChIKey | KBVQJPVOJJXJBW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |