C23H27NO3 — CID 155809297
[(3R,5S)-5-(1-benzofuran-2-yl)-3-phenylhexyl] N,N-dimethylcarbamate (PubChem CID 155809297) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is [(3R,5S)-5-(1-benzofuran-2-yl)-3-phenylhexyl] N,N-dimethylcarbamate.
| Compound Name | [(3R,5S)-5-(1-benzofuran-2-yl)-3-phenylhexyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 155809297 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [(3R,5S)-5-(1-benzofuran-2-yl)-3-phenylhexyl] N,N-dimethylcarbamate |
| SMILES | C[C@@H](C[C@H](CCOC(=O)N(C)C)c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H27NO3/c1-17(22-16-20-11-7-8-12-21(20)27-22)15-19(18-9-5-4-6-10-18)13-14-26-23(25)24(2)3/h4-12,16-17,19H,13-15H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | ICNVQSYIWXXKDS-HKUYNNGSSA-N |
| XLogP | 5.80 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |