C21H24O2 — CID 155814254
(3R,5S)-5-(1-benzofuran-2-yl)-3-phenylheptan-1-ol (PubChem CID 155814254) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (3R,5S)-5-(1-benzofuran-2-yl)-3-phenylheptan-1-ol.
| Compound Name | (3R,5S)-5-(1-benzofuran-2-yl)-3-phenylheptan-1-ol |
|---|---|
| PubChem CID | 155814254 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (3R,5S)-5-(1-benzofuran-2-yl)-3-phenylheptan-1-ol |
| SMILES | CCC(C[C@H](CCO)c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H24O2/c1-2-16(21-15-19-10-6-7-11-20(19)23-21)14-18(12-13-22)17-8-4-3-5-9-17/h3-11,15-16,18,22H,2,12-14H2,1H3/t16?,18-/m0/s1 |
| InChIKey | XHXFBLJCOYLJGV-DAFXYXGESA-N |
| XLogP | 5.48 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |