C24H26F3N7 — CID 155809697
4-[1-[4-(cycloheptylamino)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-yl]triazol-4-yl]butanenitrile (PubChem CID 155809697) has the molecular formula C24H26F3N7 and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-[1-[4-(cycloheptylamino)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-yl]triazol-4-yl]butanenitrile.
| Compound Name | 4-[1-[4-(cycloheptylamino)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-yl]triazol-4-yl]butanenitrile |
|---|---|
| PubChem CID | 155809697 |
| Molecular Formula | C24H26F3N7 |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 4-[1-[4-(cycloheptylamino)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-yl]triazol-4-yl]butanenitrile |
| SMILES | N#CCCCc1cn(-c2ncc(-c3ccc(C(F)(F)F)cc3)c(NC3CCCCCC3)n2)nn1 |
| InChI | InChI=1S/C24H26F3N7/c25-24(26,27)18-12-10-17(11-13-18)21-15-29-23(34-16-20(32-33-34)9-5-6-14-28)31-22(21)30-19-7-3-1-2-4-8-19/h10-13,15-16,19H,1-9H2,(H,29,30,31) |
| InChIKey | VYTNGQRTZXWARR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|