C24H32F3N5O — CID 155809700
4-(cycloheptylamino)-N-[3-(dimethylamino)propyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2-carboxamide (PubChem CID 155809700) has the molecular formula C24H32F3N5O and a molecular weight of 463.55 g/mol. Its IUPAC name is 4-(cycloheptylamino)-N-[3-(dimethylamino)propyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2-carboxamide.
| Compound Name | 4-(cycloheptylamino)-N-[3-(dimethylamino)propyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 155809700 |
| Molecular Formula | C24H32F3N5O |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 4-(cycloheptylamino)-N-[3-(dimethylamino)propyl]-5-[4-(trifluoromethyl)phenyl]pyrimidine-2-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1ncc(-c2ccc(C(F)(F)F)cc2)c(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C24H32F3N5O/c1-32(2)15-7-14-28-23(33)22-29-16-20(17-10-12-18(13-11-17)24(25,26)27)21(31-22)30-19-8-5-3-4-6-9-19/h10-13,16,19H,3-9,14-15H2,1-2H3,(H,28,33)(H,29,30,31) |
| InChIKey | BPDFCEGPSBNTBS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|