C20H24ClNO4 — CID 155811967
[1-(1-adamantylamino)-3-hydroxy-1-oxopropan-2-yl] 4-chlorobenzoate (PubChem CID 155811967) has the molecular formula C20H24ClNO4 and a molecular weight of 377.87 g/mol. Its IUPAC name is [1-(1-adamantylamino)-3-hydroxy-1-oxopropan-2-yl] 4-chlorobenzoate.
| Compound Name | [1-(1-adamantylamino)-3-hydroxy-1-oxopropan-2-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 155811967 |
| Molecular Formula | C20H24ClNO4 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [1-(1-adamantylamino)-3-hydroxy-1-oxopropan-2-yl] 4-chlorobenzoate |
| SMILES | O=C(OC(CO)C(=O)NC12CC3CC(CC(C3)C1)C2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO4/c21-16-3-1-15(2-4-16)19(25)26-17(11-23)18(24)22-20-8-12-5-13(9-20)7-14(6-12)10-20/h1-4,12-14,17,23H,5-11H2,(H,22,24) |
| InChIKey | MMLBPUQTTRGKPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |