C23H25Cl2NO5 — CID 155812032
ethyl (2S,3R,4S)-4-(but-3-enoylamino)-5-[4-(3,5-dichlorophenyl)phenyl]-2,3-dihydroxypentanoate (PubChem CID 155812032) has the molecular formula C23H25Cl2NO5 and a molecular weight of 466.36 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-4-(but-3-enoylamino)-5-[4-(3,5-dichlorophenyl)phenyl]-2,3-dihydroxypentanoate.
| Compound Name | ethyl (2S,3R,4S)-4-(but-3-enoylamino)-5-[4-(3,5-dichlorophenyl)phenyl]-2,3-dihydroxypentanoate |
|---|---|
| PubChem CID | 155812032 |
| Molecular Formula | C23H25Cl2NO5 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | ethyl (2S,3R,4S)-4-(but-3-enoylamino)-5-[4-(3,5-dichlorophenyl)phenyl]-2,3-dihydroxypentanoate |
| SMILES | C=CCC(=O)N[C@@H](Cc1ccc(-c2cc(Cl)cc(Cl)c2)cc1)[C@@H](O)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C23H25Cl2NO5/c1-3-5-20(27)26-19(21(28)22(29)23(30)31-4-2)10-14-6-8-15(9-7-14)16-11-17(24)13-18(25)12-16/h3,6-9,11-13,19,21-22,28-29H,1,4-5,10H2,2H3,(H,26,27)/t19-,21+,22-/m0/s1 |
| InChIKey | MTWLBPCEUYRJIC-NNWRFLSQSA-N |
| XLogP | 3.55 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|