C17H14FN3OS — CID 155815627
1-(4-fluorophenyl)-3-(2-methyl-6-thiophen-2-yl-3-pyridinyl)urea (PubChem CID 155815627) has the molecular formula C17H14FN3OS and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-(2-methyl-6-thiophen-2-yl-3-pyridinyl)urea.
| Compound Name | 1-(4-fluorophenyl)-3-(2-methyl-6-thiophen-2-yl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 155815627 |
| Molecular Formula | C17H14FN3OS |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 1-(4-fluorophenyl)-3-(2-methyl-6-thiophen-2-yl-3-pyridinyl)urea |
| SMILES | Cc1nc(-c2cccs2)ccc1NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14FN3OS/c1-11-14(8-9-15(19-11)16-3-2-10-23-16)21-17(22)20-13-6-4-12(18)5-7-13/h2-10H,1H3,(H2,20,21,22) |
| InChIKey | BRPBKBILQAASLD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |