C20H24BrNO4 — CID 155816952
[3-(1-adamantylamino)-2-hydroxy-3-oxopropyl] 3-bromobenzoate (PubChem CID 155816952) has the molecular formula C20H24BrNO4 and a molecular weight of 422.32 g/mol. Its IUPAC name is [3-(1-adamantylamino)-2-hydroxy-3-oxopropyl] 3-bromobenzoate.
| Compound Name | [3-(1-adamantylamino)-2-hydroxy-3-oxopropyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 155816952 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | [3-(1-adamantylamino)-2-hydroxy-3-oxopropyl] 3-bromobenzoate |
| SMILES | O=C(OCC(O)C(=O)NC12CC3CC(CC(C3)C1)C2)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H24BrNO4/c21-16-3-1-2-15(7-16)19(25)26-11-17(23)18(24)22-20-8-12-4-13(9-20)6-14(5-12)10-20/h1-3,7,12-14,17,23H,4-6,8-11H2,(H,22,24) |
| InChIKey | XNDSUMWZDZDHCK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |