C17H25F3N4O4 — CID 155823553
(7R,8aS)-7-(2-methoxyethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid (PubChem CID 155823553) has the molecular formula C17H25F3N4O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is (7R,8aS)-7-(2-methoxyethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid.
| Compound Name | (7R,8aS)-7-(2-methoxyethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823553 |
| Molecular Formula | C17H25F3N4O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (7R,8aS)-7-(2-methoxyethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
| SMILES | COCCO[C@@H]1C[C@H]2CN(c3ncc(C)cn3)CCN2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4O2.C2HF3O2/c1-12-8-16-15(17-9-12)19-4-3-18-11-14(7-13(18)10-19)21-6-5-20-2;3-2(4,5)1(6)7/h8-9,13-14H,3-7,10-11H2,1-2H3;(H,6,7)/t13-,14+;/m0./s1 |
| InChIKey | ZIRALFFMZNKLLX-LMRHVHIWSA-N |
| XLogP | 1.34 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|