C24H25F6N5O4 — CID 155823631
3-[[(2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-yl)amino]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823631) has the molecular formula C24H25F6N5O4 and a molecular weight of 561.48 g/mol. Its IUPAC name is 3-[[(2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-yl)amino]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[[(2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-yl)amino]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823631 |
| Molecular Formula | C24H25F6N5O4 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 3-[[(2-pyrrolidin-1-yl-5,6,7,8-tetrahydroquinazolin-6-yl)amino]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
| SMILES | N#Cc1cccc(CNC2CCc3nc(N4CCCC4)ncc3C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23N5.2C2HF3O2/c21-12-15-4-3-5-16(10-15)13-22-18-6-7-19-17(11-18)14-23-20(24-19)25-8-1-2-9-25;2*3-2(4,5)1(6)7/h3-5,10,14,18,22H,1-2,6-9,11,13H2;2*(H,6,7) |
| InChIKey | FCYGOYYUZQOSPN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |