C20H22F6N4O4S — CID 155848184
2-N-cyclopropyl-6-N-(thiophen-2-ylmethyl)-5,6,7,8-tetrahydroquinazoline-2,6-diamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848184) has the molecular formula C20H22F6N4O4S and a molecular weight of 528.48 g/mol. Its IUPAC name is 2-N-cyclopropyl-6-N-(thiophen-2-ylmethyl)-5,6,7,8-tetrahydroquinazoline-2,6-diamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-N-cyclopropyl-6-N-(thiophen-2-ylmethyl)-5,6,7,8-tetrahydroquinazoline-2,6-diamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848184 |
| Molecular Formula | C20H22F6N4O4S |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2-N-cyclopropyl-6-N-(thiophen-2-ylmethyl)-5,6,7,8-tetrahydroquinazoline-2,6-diamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CNC2CCc3nc(NC4CC4)ncc3C2)c1 |
| InChI | InChI=1S/C16H20N4S.2C2HF3O2/c1-2-14(21-7-1)10-17-13-5-6-15-11(8-13)9-18-16(20-15)19-12-3-4-12;2*3-2(4,5)1(6)7/h1-2,7,9,12-13,17H,3-6,8,10H2,(H,18,19,20);2*(H,6,7) |
| InChIKey | SOUGWKQOPYSIAJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |