C16H16F3N5O2S2 — CID 166274910
N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]-4,5,6,7-tetrahydro-2H-benzotriazol-5-amine;2,2,2-trifluoroacetic acid (PubChem CID 166274910) has the molecular formula C16H16F3N5O2S2 and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]-4,5,6,7-tetrahydro-2H-benzotriazol-5-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]-4,5,6,7-tetrahydro-2H-benzotriazol-5-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166274910 |
| Molecular Formula | C16H16F3N5O2S2 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | N-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methyl]-4,5,6,7-tetrahydro-2H-benzotriazol-5-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(-c2nc(CNC3CCc4n[nH]nc4C3)cs2)c1 |
| InChI | InChI=1S/C14H15N5S2.C2HF3O2/c1-2-13(20-5-1)14-16-10(8-21-14)7-15-9-3-4-11-12(6-9)18-19-17-11;3-2(4,5)1(6)7/h1-2,5,8-9,15H,3-4,6-7H2,(H,17,18,19);(H,6,7) |
| InChIKey | DKDOQNANIIKWPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |