C28H25F6N5O4 — CID 155863795
3-[[11-(benzylamino)-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863795) has the molecular formula C28H25F6N5O4 and a molecular weight of 609.53 g/mol. Its IUPAC name is 3-[[11-(benzylamino)-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-[[11-(benzylamino)-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863795 |
| Molecular Formula | C28H25F6N5O4 |
| Molecular Weight | 609.53 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 3-[[11-(benzylamino)-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methyl]benzonitrile;bis(2,2,2-trifluoroacetic acid) |
| SMILES | N#Cc1cccc(CN2CC3Cc4cnc(NCc5ccccc5)nc4C3C2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H23N5.2C2HF3O2/c25-11-18-7-4-8-19(9-18)14-29-15-21-10-20-13-27-24(28-23(20)22(21)16-29)26-12-17-5-2-1-3-6-17;2*3-2(4,5)1(6)7/h1-9,13,21-22H,10,12,14-16H2,(H,26,27,28);2*(H,6,7) |
| InChIKey | XALYIGFRWPASTB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |