C26H23F7N4O4 — CID 155851491
4-[(4-fluorophenyl)methyl]-N-phenyl-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-11-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155851491) has the molecular formula C26H23F7N4O4 and a molecular weight of 588.48 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-N-phenyl-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-11-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[(4-fluorophenyl)methyl]-N-phenyl-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-11-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155851491 |
| Molecular Formula | C26H23F7N4O4 |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-N-phenyl-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-11-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Fc1ccc(CN2CC3Cc4cnc(Nc5ccccc5)nc4C3C2)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H21FN4.2C2HF3O2/c23-18-8-6-15(7-9-18)12-27-13-17-10-16-11-24-22(26-21(16)20(17)14-27)25-19-4-2-1-3-5-19;2*3-2(4,5)1(6)7/h1-9,11,17,20H,10,12-14H2,(H,24,25,26);2*(H,6,7) |
| InChIKey | YMGSDNRVOIRXLN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |