C24H19F5N2O4S — CID 171692425
2-[(4-fluorophenyl)methyl]-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 171692425) has the molecular formula C24H19F5N2O4S and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171692425 |
| Molecular Formula | C24H19F5N2O4S |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-7-(6-fluoro-3-pyridinyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S1(=O)c2ccc(-c3ccc(F)nc3)cc2C2CN(Cc3ccc(F)cc3)CC21 |
| InChI | InChI=1S/C22H18F2N2O2S.C2HF3O2/c23-17-5-1-14(2-6-17)11-26-12-19-18-9-15(16-4-8-22(24)25-10-16)3-7-20(18)29(27,28)21(19)13-26;3-2(4,5)1(6)7/h1-10,19,21H,11-13H2;(H,6,7) |
| InChIKey | HKHZCFVLRGRRHE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|