C21H18F3NO6S — CID 155839854
7-(furan-3-yl)-2-(furan-3-ylmethyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 155839854) has the molecular formula C21H18F3NO6S and a molecular weight of 469.44 g/mol. Its IUPAC name is 7-(furan-3-yl)-2-(furan-3-ylmethyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(furan-3-yl)-2-(furan-3-ylmethyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839854 |
| Molecular Formula | C21H18F3NO6S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 7-(furan-3-yl)-2-(furan-3-ylmethyl)-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrole 4,4-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S1(=O)c2ccc(-c3ccoc3)cc2C2CN(Cc3ccoc3)CC21 |
| InChI | InChI=1S/C19H17NO4S.C2HF3O2/c21-25(22)18-2-1-14(15-4-6-24-12-15)7-16(18)17-9-20(10-19(17)25)8-13-3-5-23-11-13;3-2(4,5)1(6)7/h1-7,11-12,17,19H,8-10H2;(H,6,7) |
| InChIKey | IYYVDGFYPZLQBN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |