C23H22F3N5O2S — CID 178006924
2-N-(2-benzyl-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-7-yl)-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 178006924) has the molecular formula C23H22F3N5O2S and a molecular weight of 489.52 g/mol. Its IUPAC name is 2-N-(2-benzyl-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-7-yl)-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-benzyl-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-7-yl)-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 178006924 |
| Molecular Formula | C23H22F3N5O2S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-N-(2-benzyl-4,4-dioxo-1,3,3a,8b-tetrahydro-[1]benzothiolo[2,3-c]pyrrol-7-yl)-4-N-methyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc3c(c2)C2CN(Cc4ccccc4)CC2S3(=O)=O)ncc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3N5O2S/c1-27-21-18(23(24,25)26)10-28-22(30-21)29-15-7-8-19-16(9-15)17-12-31(13-20(17)34(19,32)33)11-14-5-3-2-4-6-14/h2-10,17,20H,11-13H2,1H3,(H2,27,28,29,30) |
| InChIKey | KSKXSMPELMPRRI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |