C19H21F3N4O6S2 — CID 155826550
(2R,6S)-N-benzyl-4-methylsulfonyl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine;2,2,2-trifluoroacetic acid (PubChem CID 155826550) has the molecular formula C19H21F3N4O6S2 and a molecular weight of 522.53 g/mol. Its IUPAC name is (2R,6S)-N-benzyl-4-methylsulfonyl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,6S)-N-benzyl-4-methylsulfonyl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826550 |
| Molecular Formula | C19H21F3N4O6S2 |
| Molecular Weight | 522.53 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | (2R,6S)-N-benzyl-4-methylsulfonyl-7,7-dioxo-7λ6-thia-4,11,13-triazatricyclo[7.4.0.02,6]trideca-1(13),9,11-trien-12-amine;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N1C[C@@H]2c3nc(NCc4ccccc4)ncc3CS(=O)(=O)[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H20N4O4S2.C2HF3O2/c1-26(22,23)21-9-14-15(10-21)27(24,25)11-13-8-19-17(20-16(13)14)18-7-12-5-3-2-4-6-12;3-2(4,5)1(6)7/h2-6,8,14-15H,7,9-11H2,1H3,(H,18,19,20);(H,6,7)/t14-,15+;/m0./s1 |
| InChIKey | FQSUIZQUPLRJOR-LDXVYITESA-N |
| XLogP | 1.38 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |