C19H27F3N4O5S2 — CID 155828738
9-cyclopropylsulfonyl-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155828738) has the molecular formula C19H27F3N4O5S2 and a molecular weight of 512.58 g/mol. Its IUPAC name is 9-cyclopropylsulfonyl-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-cyclopropylsulfonyl-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828738 |
| Molecular Formula | C19H27F3N4O5S2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 9-cyclopropylsulfonyl-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCN(C)C3(CCN(S(=O)(=O)C4CC4)CC3)C2=O)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O3S2.C2HF3O2/c1-13-18-14(12-25-13)11-20-10-9-19(2)17(16(20)22)5-7-21(8-6-17)26(23,24)15-3-4-15;3-2(4,5)1(6)7/h12,15H,3-11H2,1-2H3;(H,6,7) |
| InChIKey | GQHKFBXCQPEKCP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |