C21H30F3N5O4S — CID 155826402
N-cyclopentyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826402) has the molecular formula C21H30F3N5O4S and a molecular weight of 505.56 g/mol. Its IUPAC name is N-cyclopentyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopentyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826402 |
| Molecular Formula | C21H30F3N5O4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-cyclopentyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCNC(=O)C23CCN(C(=O)NC2CCCC2)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29N5O2S.C2HF3O2/c1-14-21-16(13-27-14)12-24-11-8-20-17(25)19(24)6-9-23(10-7-19)18(26)22-15-4-2-3-5-15;3-2(4,5)1(6)7/h13,15H,2-12H2,1H3,(H,20,25)(H,22,26);(H,6,7) |
| InChIKey | RZBGKQOFNRSOSN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |