C18H24F3N3O3S — CID 155829877
1-prop-2-enyl-8-(1,3-thiazol-2-ylmethyl)-1,8-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 155829877) has the molecular formula C18H24F3N3O3S and a molecular weight of 419.47 g/mol. Its IUPAC name is 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethyl)-1,8-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethyl)-1,8-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829877 |
| Molecular Formula | C18H24F3N3O3S |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-prop-2-enyl-8-(1,3-thiazol-2-ylmethyl)-1,8-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1C(=O)CCCC12CCCN(Cc1nccs1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3OS.C2HF3O2/c1-2-9-19-15(20)5-3-6-16(19)7-4-10-18(13-16)12-14-17-8-11-21-14;3-2(4,5)1(6)7/h2,8,11H,1,3-7,9-10,12-13H2;(H,6,7) |
| InChIKey | VWWLQCIBXIFHHE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|