C20H26F6N4O5S — CID 155847146
1-methyl-4-prop-2-enyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847146) has the molecular formula C20H26F6N4O5S and a molecular weight of 548.51 g/mol. Its IUPAC name is 1-methyl-4-prop-2-enyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-methyl-4-prop-2-enyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847146 |
| Molecular Formula | C20H26F6N4O5S |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 1-methyl-4-prop-2-enyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1CCN(C)C2(CCN(Cc3nccs3)CC2)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4OS.2C2HF3O2/c1-3-7-20-11-10-18(2)16(15(20)21)4-8-19(9-5-16)13-14-17-6-12-22-14;2*3-2(4,5)1(6)7/h3,6,12H,1,4-5,7-11,13H2,2H3;2*(H,6,7) |
| InChIKey | JHVZKCVNQSSRMS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|