C19H26F6N4O5S — CID 155845412
4-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845412) has the molecular formula C19H26F6N4O5S and a molecular weight of 536.50 g/mol. Its IUPAC name is 4-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845412 |
| Molecular Formula | C19H26F6N4O5S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | 4-ethyl-1-methyl-9-(1,3-thiazol-2-ylmethyl)-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCN1CCN(C)C2(CCN(Cc3nccs3)CC2)C1=O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4OS.2C2HF3O2/c1-3-19-10-9-17(2)15(14(19)20)4-7-18(8-5-15)12-13-16-6-11-21-13;2*3-2(4,5)1(6)7/h6,11H,3-5,7-10,12H2,1-2H3;2*(H,6,7) |
| InChIKey | IHAFZHCMVIQXHP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |