C21H26F7N5O6 — CID 155837357
2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155837357) has the molecular formula C21H26F7N5O6 and a molecular weight of 577.45 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155837357 |
| Molecular Formula | C21H26F7N5O6 |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(4-methylpiperazin-1-yl)ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN1CCN(C(=O)C[C@H]2C[C@H]3CN(c4ncc(F)cn4)C[C@H]3O2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24FN5O2.2C2HF3O2/c1-21-2-4-22(5-3-21)16(24)7-14-6-12-10-23(11-15(12)25-14)17-19-8-13(18)9-20-17;2*3-2(4,5)1(6)7/h8-9,12,14-15H,2-7,10-11H2,1H3;2*(H,6,7)/t12-,14+,15+;;/m0../s1 |
| InChIKey | GOIJTEYVCVITPA-MVDHWJGESA-N |
| XLogP | 1.64 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |