C20H33F3N2O5 — CID 155838552
methyl 4-oxo-4-(1-pentyl-1,9-diazaspiro[4.5]decan-9-yl)butanoate;2,2,2-trifluoroacetic acid (PubChem CID 155838552) has the molecular formula C20H33F3N2O5 and a molecular weight of 438.49 g/mol. Its IUPAC name is methyl 4-oxo-4-(1-pentyl-1,9-diazaspiro[4.5]decan-9-yl)butanoate;2,2,2-trifluoroacetic acid.
| Compound Name | methyl 4-oxo-4-(1-pentyl-1,9-diazaspiro[4.5]decan-9-yl)butanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155838552 |
| Molecular Formula | C20H33F3N2O5 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | methyl 4-oxo-4-(1-pentyl-1,9-diazaspiro[4.5]decan-9-yl)butanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN1CCCC12CCCN(C(=O)CCC(=O)OC)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H32N2O3.C2HF3O2/c1-3-4-5-13-20-14-7-11-18(20)10-6-12-19(15-18)16(21)8-9-17(22)23-2;3-2(4,5)1(6)7/h3-15H2,1-2H3;(H,6,7) |
| InChIKey | YDQMGNRAOWJYIN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|