C23H25F3N4O7S — CID 155844880
(1S,5S,7R)-N-(3-methoxyphenyl)-4,4-dioxo-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155844880) has the molecular formula C23H25F3N4O7S and a molecular weight of 558.54 g/mol. Its IUPAC name is (1S,5S,7R)-N-(3-methoxyphenyl)-4,4-dioxo-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5S,7R)-N-(3-methoxyphenyl)-4,4-dioxo-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844880 |
| Molecular Formula | C23H25F3N4O7S |
| Molecular Weight | 558.54 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | (1S,5S,7R)-N-(3-methoxyphenyl)-4,4-dioxo-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(NC(=O)N2C[C@H]3C[C@H]4[C@](C2)(CN(Cc2ccncc2)S4(=O)=O)O3)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H24N4O5S.C2HF3O2/c1-29-17-4-2-3-16(9-17)23-20(26)24-12-18-10-19-21(13-24,30-18)14-25(31(19,27)28)11-15-5-7-22-8-6-15;3-2(4,5)1(6)7/h2-9,18-19H,10-14H2,1H3,(H,23,26);(H,6,7)/t18-,19+,21+;/m1./s1 |
| InChIKey | NQKJVZJVQVFDHD-LINKRLRISA-N |
| XLogP | 2.31 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |