C24H27F3N4O6S — CID 171673076
(1S,5S,7R)-4,4-dioxo-N-(2-phenylethyl)-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 171673076) has the molecular formula C24H27F3N4O6S and a molecular weight of 556.56 g/mol. Its IUPAC name is (1S,5S,7R)-4,4-dioxo-N-(2-phenylethyl)-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,5S,7R)-4,4-dioxo-N-(2-phenylethyl)-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171673076 |
| Molecular Formula | C24H27F3N4O6S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | (1S,5S,7R)-4,4-dioxo-N-(2-phenylethyl)-3-(pyridin-4-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCCc1ccccc1)N1C[C@H]2C[C@H]3[C@](C1)(CN(Cc1ccncc1)S3(=O)=O)O2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26N4O4S.C2HF3O2/c27-21(24-11-8-17-4-2-1-3-5-17)25-14-19-12-20-22(15-25,30-19)16-26(31(20,28)29)13-18-6-9-23-10-7-18;3-2(4,5)1(6)7/h1-7,9-10,19-20H,8,11-16H2,(H,24,27);(H,6,7)/t19-,20+,22+;/m1./s1 |
| InChIKey | XJJJXOXXFLJNTP-YBSNCERTSA-N |
| XLogP | 2.02 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |