C20H27N3O4S — CID 155902648
(1S,5S,7R)-3-benzyl-N-cyclopentyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide (PubChem CID 155902648) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is (1S,5S,7R)-3-benzyl-N-cyclopentyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide.
| Compound Name | (1S,5S,7R)-3-benzyl-N-cyclopentyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 155902648 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (1S,5S,7R)-3-benzyl-N-cyclopentyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
| SMILES | O=C(NC1CCCC1)N1C[C@H]2C[C@H]3[C@](C1)(CN(Cc1ccccc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C20H27N3O4S/c24-19(21-16-8-4-5-9-16)22-12-17-10-18-20(13-22,27-17)14-23(28(18,25)26)11-15-6-2-1-3-7-15/h1-3,6-7,16-18H,4-5,8-14H2,(H,21,24)/t17-,18+,20+/m1/s1 |
| InChIKey | XZTVIVYKFRPQES-HBFSDRIKSA-N |
| XLogP | 1.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |