C19H20ClN3O5S — CID 97441498
[(1S,5S,7R)-3-[(4-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 97441498) has the molecular formula C19H20ClN3O5S and a molecular weight of 437.91 g/mol. Its IUPAC name is [(1S,5S,7R)-3-[(4-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(5-methyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [(1S,5S,7R)-3-[(4-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(5-methyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 97441498 |
| Molecular Formula | C19H20ClN3O5S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [(1S,5S,7R)-3-[(4-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@H]3C[C@H]4[C@](C2)(CN(Cc2ccc(Cl)cc2)S4(=O)=O)O3)no1 |
| InChI | InChI=1S/C19H20ClN3O5S/c1-12-6-16(21-28-12)18(24)22-9-15-7-17-19(10-22,27-15)11-23(29(17,25)26)8-13-2-4-14(20)5-3-13/h2-6,15,17H,7-11H2,1H3/t15-,17+,19+/m1/s1 |
| InChIKey | UHLWVVRHCWBHKN-AYBZRNKSSA-N |
| XLogP | 1.83 |
| TPSA | 92.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |