C16H20ClN3O5S — CID 131688871
(6-chloro-2-pyridinyl)-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone (PubChem CID 131688871) has the molecular formula C16H20ClN3O5S and a molecular weight of 401.87 g/mol. Its IUPAC name is (6-chloro-2-pyridinyl)-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone.
| Compound Name | (6-chloro-2-pyridinyl)-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 131688871 |
| Molecular Formula | C16H20ClN3O5S |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (6-chloro-2-pyridinyl)-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
| SMILES | COCCN1C[C@@]23CN(C(=O)c4cccc(Cl)n4)C[C@@H](C[C@@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C16H20ClN3O5S/c1-24-6-5-20-10-16-9-19(15(21)12-3-2-4-14(17)18-12)8-11(25-16)7-13(16)26(20,22)23/h2-4,11,13H,5-10H2,1H3/t11-,13+,16+/m1/s1 |
| InChIKey | FDBCDQWQCKYDBL-FFSVYQOJSA-N |
| XLogP | 0.38 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|