C17H20N4O4S — CID 155869940
[(5S,7R)-3-methyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methylimidazo[1,2-a]pyridin-2-yl)methanone (PubChem CID 155869940) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is [(5S,7R)-3-methyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methylimidazo[1,2-a]pyridin-2-yl)methanone.
| Compound Name | [(5S,7R)-3-methyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methylimidazo[1,2-a]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 155869940 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(5S,7R)-3-methyl-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methylimidazo[1,2-a]pyridin-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2C[C@H]3C[C@H]4C(C2)(CN(C)S4(=O)=O)O3)nc2ccccn12 |
| InChI | InChI=1S/C17H20N4O4S/c1-11-15(18-14-5-3-4-6-21(11)14)16(22)20-8-12-7-13-17(10-20,25-12)9-19(2)26(13,23)24/h3-6,12-13H,7-10H2,1-2H3/t12-,13+,17?/m1/s1 |
| InChIKey | JBIJFGJDRVINCR-LABGONDVSA-N |
| XLogP | 0.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |