C14H18FN3O4S2 — CID 155871497
[(1S,5S,7R)-3-(2-fluoroethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(2-methyl-1,3-thiazol-4-yl)methanone (PubChem CID 155871497) has the molecular formula C14H18FN3O4S2 and a molecular weight of 375.45 g/mol. Its IUPAC name is [(1S,5S,7R)-3-(2-fluoroethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(2-methyl-1,3-thiazol-4-yl)methanone.
| Compound Name | [(1S,5S,7R)-3-(2-fluoroethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 155871497 |
| Molecular Formula | C14H18FN3O4S2 |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | [(1S,5S,7R)-3-(2-fluoroethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(2-methyl-1,3-thiazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2C[C@H]3C[C@H]4[C@](C2)(CN(CCF)S4(=O)=O)O3)cs1 |
| InChI | InChI=1S/C14H18FN3O4S2/c1-9-16-11(6-23-9)13(19)17-5-10-4-12-14(7-17,22-10)8-18(3-2-15)24(12,20)21/h6,10,12H,2-5,7-8H2,1H3/t10-,12+,14+/m1/s1 |
| InChIKey | MJWCVQRMIUINCY-OSMZGAPFSA-N |
| XLogP | 0.42 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |