C22H25N3O5S — CID 97441553
[(1S,5S,7R)-3-[2-(4-methoxyphenyl)ethyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone (PubChem CID 97441553) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is [(1S,5S,7R)-3-[2-(4-methoxyphenyl)ethyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1S,5S,7R)-3-[2-(4-methoxyphenyl)ethyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97441553 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [(1S,5S,7R)-3-[2-(4-methoxyphenyl)ethyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone |
| SMILES | COc1ccc(CCN2C[C@@]34CN(C(=O)c5cccnc5)C[C@@H](C[C@@H]3S2(=O)=O)O4)cc1 |
| InChI | InChI=1S/C22H25N3O5S/c1-29-18-6-4-16(5-7-18)8-10-25-15-22-14-24(21(26)17-3-2-9-23-12-17)13-19(30-22)11-20(22)31(25,27)28/h2-7,9,12,19-20H,8,10-11,13-15H2,1H3/t19-,20+,22+/m1/s1 |
| InChIKey | POVQPQWVFOLPTA-URVUXULASA-N |
| XLogP | 1.33 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |