C19H20N4O4S — CID 133135599
[(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-4-ylmethanone (PubChem CID 133135599) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is [(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-4-ylmethanone.
| Compound Name | [(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 133135599 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1C[C@@H]2C[C@@H]3[C@@](C1)(CN(Cc1cccnc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C19H20N4O4S/c24-18(15-3-6-20-7-4-15)22-11-16-8-17-19(12-22,27-16)13-23(28(17,25)26)10-14-2-1-5-21-9-14/h1-7,9,16-17H,8,10-13H2/t16-,17+,19+/m0/s1 |
| InChIKey | IXVAEGUJBKYHSW-YQVWRLOYSA-N |
| XLogP | 0.67 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |