C20H20ClN3O4S — CID 133140551
(4-chlorophenyl)-[(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone (PubChem CID 133140551) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is (4-chlorophenyl)-[(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone.
| Compound Name | (4-chlorophenyl)-[(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 133140551 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (4-chlorophenyl)-[(1R,5R,7S)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1C[C@@H]2C[C@@H]3[C@@](C1)(CN(Cc1cccnc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C20H20ClN3O4S/c21-16-5-3-15(4-6-16)19(25)23-11-17-8-18-20(12-23,28-17)13-24(29(18,26)27)10-14-2-1-7-22-9-14/h1-7,9,17-18H,8,10-13H2/t17-,18+,20+/m0/s1 |
| InChIKey | VPJKWTQDGXKPLQ-NLWGTHIKSA-N |
| XLogP | 1.93 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |