C21H24N4O4S — CID 133142275
(1R,5R,7S)-N-(2-methylphenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide (PubChem CID 133142275) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is (1R,5R,7S)-N-(2-methylphenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide.
| Compound Name | (1R,5R,7S)-N-(2-methylphenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 133142275 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (1R,5R,7S)-N-(2-methylphenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
| SMILES | Cc1ccccc1NC(=O)N1C[C@@H]2C[C@@H]3[C@@](C1)(CN(Cc1cccnc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C21H24N4O4S/c1-15-5-2-3-7-18(15)23-20(26)24-12-17-9-19-21(13-24,29-17)14-25(30(19,27)28)11-16-6-4-8-22-10-16/h2-8,10,17,19H,9,11-14H2,1H3,(H,23,26)/t17-,19+,21+/m0/s1 |
| InChIKey | GGPIKXPGGAOOQG-FBBABVLZSA-N |
| XLogP | 1.98 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |