C17H23N3O4S — CID 97441571
(1S,5S,7R)-3-ethyl-N-(2-methylphenyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide (PubChem CID 97441571) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is (1S,5S,7R)-3-ethyl-N-(2-methylphenyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide.
| Compound Name | (1S,5S,7R)-3-ethyl-N-(2-methylphenyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 97441571 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (1S,5S,7R)-3-ethyl-N-(2-methylphenyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
| SMILES | CCN1C[C@@]23CN(C(=O)Nc4ccccc4C)C[C@@H](C[C@@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C17H23N3O4S/c1-3-20-11-17-10-19(9-13(24-17)8-15(17)25(20,22)23)16(21)18-14-7-5-4-6-12(14)2/h4-7,13,15H,3,8-11H2,1-2H3,(H,18,21)/t13-,15+,17+/m1/s1 |
| InChIKey | HEBHBMQXYZRKQJ-KMFMINBZSA-N |
| XLogP | 1.40 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |