C19H26N2O6S — CID 97441642
1-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-2-(3-methoxyphenyl)ethanone (PubChem CID 97441642) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 97441642 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[(1S,5S,7R)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-2-(3-methoxyphenyl)ethanone |
| SMILES | COCCN1C[C@@]23CN(C(=O)Cc4cccc(OC)c4)C[C@@H](C[C@@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C19H26N2O6S/c1-25-7-6-21-13-19-12-20(11-16(27-19)10-17(19)28(21,23)24)18(22)9-14-4-3-5-15(8-14)26-2/h3-5,8,16-17H,6-7,9-13H2,1-2H3/t16-,17+,19+/m1/s1 |
| InChIKey | WLUJJVCTKRXKGP-AOIWGVFYSA-N |
| XLogP | 0.27 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |