C18H24N2O6S — CID 133141051
[(1R,5R,7S)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methoxyphenyl)methanone (PubChem CID 133141051) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is [(1R,5R,7S)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(1R,5R,7S)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 133141051 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [(1R,5R,7S)-3-(2-methoxyethyl)-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-(3-methoxyphenyl)methanone |
| SMILES | COCCN1C[C@]23CN(C(=O)c4cccc(OC)c4)C[C@H](C[C@H]2S1(=O)=O)O3 |
| InChI | InChI=1S/C18H24N2O6S/c1-24-7-6-20-12-18-11-19(10-15(26-18)9-16(18)27(20,22)23)17(21)13-4-3-5-14(8-13)25-2/h3-5,8,15-16H,6-7,9-12H2,1-2H3/t15-,16+,18+/m0/s1 |
| InChIKey | XSLFHXZAOVNUFM-LZLYRXPVSA-N |
| XLogP | 0.34 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |