C20H20ClN3O4S — CID 133141059
[(1R,5R,7S)-3-[(3-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone (PubChem CID 133141059) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is [(1R,5R,7S)-3-[(3-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1R,5R,7S)-3-[(3-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 133141059 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | [(1R,5R,7S)-3-[(3-chlorophenyl)methyl]-4,4-dioxo-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1C[C@@H]2C[C@@H]3[C@@](C1)(CN(Cc1cccc(Cl)c1)S3(=O)=O)O2 |
| InChI | InChI=1S/C20H20ClN3O4S/c21-16-5-1-3-14(7-16)10-24-13-20-12-23(19(25)15-4-2-6-22-9-15)11-17(28-20)8-18(20)29(24,26)27/h1-7,9,17-18H,8,10-13H2/t17-,18+,20+/m0/s1 |
| InChIKey | GKFCMTFJGMBNJI-NLWGTHIKSA-N |
| XLogP | 1.93 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |