C20H21FN4O4S — CID 133135594
(1R,5R,7S)-N-(4-fluorophenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide (PubChem CID 133135594) has the molecular formula C20H21FN4O4S and a molecular weight of 432.48 g/mol. Its IUPAC name is (1R,5R,7S)-N-(4-fluorophenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide.
| Compound Name | (1R,5R,7S)-N-(4-fluorophenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
|---|---|
| PubChem CID | 133135594 |
| Molecular Formula | C20H21FN4O4S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (1R,5R,7S)-N-(4-fluorophenyl)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecane-9-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)N1C[C@@H]2C[C@@H]3[C@@](C1)(CN(Cc1cccnc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C20H21FN4O4S/c21-15-3-5-16(6-4-15)23-19(26)24-11-17-8-18-20(12-24,29-17)13-25(30(18,27)28)10-14-2-1-7-22-9-14/h1-7,9,17-18H,8,10-13H2,(H,23,26)/t17-,18+,20+/m0/s1 |
| InChIKey | OZJFOBQNSAIRTR-NLWGTHIKSA-N |
| XLogP | 1.81 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |