C18H23N3O4S — CID 155902491
cyclobutyl-[(1S,5S,7R)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone (PubChem CID 155902491) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is cyclobutyl-[(1S,5S,7R)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone.
| Compound Name | cyclobutyl-[(1S,5S,7R)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
|---|---|
| PubChem CID | 155902491 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | cyclobutyl-[(1S,5S,7R)-4,4-dioxo-3-(pyridin-3-ylmethyl)-11-oxa-4λ6-thia-3,9-diazatricyclo[5.3.1.01,5]undecan-9-yl]methanone |
| SMILES | O=C(C1CCC1)N1C[C@H]2C[C@H]3[C@](C1)(CN(Cc1cccnc1)S3(=O)=O)O2 |
| InChI | InChI=1S/C18H23N3O4S/c22-17(14-4-1-5-14)20-10-15-7-16-18(11-20,25-15)12-21(26(16,23)24)9-13-3-2-6-19-8-13/h2-3,6,8,14-16H,1,4-5,7,9-12H2/t15-,16+,18+/m1/s1 |
| InChIKey | BMQLICKCLCMXCT-RYRKJORJSA-N |
| XLogP | 0.77 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |