C19H23F6N3O6S — CID 155845272
(3aS,4S,7aS)-N-cyclopropyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845272) has the molecular formula C19H23F6N3O6S and a molecular weight of 535.46 g/mol. Its IUPAC name is (3aS,4S,7aS)-N-cyclopropyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,4S,7aS)-N-cyclopropyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845272 |
| Molecular Formula | C19H23F6N3O6S |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 535.12 |
| IUPAC Name | (3aS,4S,7aS)-N-cyclopropyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(NC1CC1)[C@@H]1CN(Cc2nccs2)C[C@H]2OCC[C@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N3O2S.2C2HF3O2/c19-15(17-10-1-2-10)12-7-18(9-14-16-4-6-21-14)8-13-11(12)3-5-20-13;2*3-2(4,5)1(6)7/h4,6,10-13H,1-3,5,7-9H2,(H,17,19);2*(H,6,7)/t11-,12+,13+;;/m0../s1 |
| InChIKey | VBZAZSAOFPGWTP-QDDWCWDGSA-N |
| XLogP | 2.53 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |