C20H29F3N2O4S — CID 155845459
4a-(cyclopropylmethoxymethyl)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155845459) has the molecular formula C20H29F3N2O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4a-(cyclopropylmethoxymethyl)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(cyclopropylmethoxymethyl)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845459 |
| Molecular Formula | C20H29F3N2O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4a-(cyclopropylmethoxymethyl)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1csc(CN2CCC3OCCCC3(COCC3CC3)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N2O2S.C2HF3O2/c1-14-11-23-17(19-14)9-20-7-5-16-18(12-20,6-2-8-22-16)13-21-10-15-3-4-15;3-2(4,5)1(6)7/h11,15-16H,2-10,12-13H2,1H3;(H,6,7) |
| InChIKey | RHSTXFNLRBEOTF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |