C16H23F3N4O4S — CID 155848246
3-[(3S,3aR,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155848246) has the molecular formula C16H23F3N4O4S and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-[(3S,3aR,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(3S,3aR,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848246 |
| Molecular Formula | C16H23F3N4O4S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-[(3S,3aR,7aR)-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)N[C@H]1CN(Cc2nccs2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O2S.C2HF3O2/c1-17(2)14(19)16-10-8-18(9-12-15-5-7-21-12)11-4-3-6-20-13(10)11;3-2(4,5)1(6)7/h5,7,10-11,13H,3-4,6,8-9H2,1-2H3,(H,16,19);(H,6,7)/t10-,11+,13+;/m0./s1 |
| InChIKey | MGSUEPIXHVMUNS-YFYDJDKWSA-N |
| XLogP | 1.78 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |