C15H20F3N3O4S — CID 155836981
(3aR,5R,7aR)-N-methyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155836981) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is (3aR,5R,7aR)-N-methyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,5R,7aR)-N-methyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836981 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (3aR,5R,7aR)-N-methyl-1-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@H]1CC[C@@H]2[C@@H](CCN2Cc2nccs2)O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3O2S.C2HF3O2/c1-14-13(17)11-3-2-9-10(18-11)4-6-16(9)8-12-15-5-7-19-12;3-2(4,5)1(6)7/h5,7,9-11H,2-4,6,8H2,1H3,(H,14,17);(H,6,7)/t9-,10-,11-;/m1./s1 |
| InChIKey | PVLLWCZENUZJTE-QZXXHOLOSA-N |
| XLogP | 1.64 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |