C17H17F4N5O4S — CID 155852455
N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155852455) has the molecular formula C17H17F4N5O4S and a molecular weight of 463.41 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155852455 |
| Molecular Formula | C17H17F4N5O4S |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(5-fluoropyrimidin-2-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,3-thiazole-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@H]1CO[C@@H]2CN(c3ncc(F)cn3)C[C@H]12)c1cscn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H16FN5O2S.C2HF3O2/c16-10-2-18-15(19-3-10)21-4-11-9(6-23-13(11)5-21)1-17-14(22)12-7-24-8-20-12;3-2(4,5)1(6)7/h2-3,7-9,11,13H,1,4-6H2,(H,17,22);(H,6,7)/t9-,11+,13+;/m0./s1 |
| InChIKey | NPAVBUZQIHHEKQ-CJFXAZPISA-N |
| XLogP | 1.59 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |