C19H21F6N5O5S — CID 155852486
N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155852486) has the molecular formula C19H21F6N5O5S and a molecular weight of 545.46 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155852486 |
| Molecular Formula | C19H21F6N5O5S |
| Molecular Weight | 545.46 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrimidin-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cnc(NC[C@H]2CO[C@@H]3CN(Cc4nccs4)C[C@H]23)nc1 |
| InChI | InChI=1S/C15H19N5OS.2C2HF3O2/c1-2-17-15(18-3-1)19-6-11-10-21-13-8-20(7-12(11)13)9-14-16-4-5-22-14;2*3-2(4,5)1(6)7/h1-5,11-13H,6-10H2,(H,17,18,19);2*(H,6,7)/t11-,12+,13+;;/m0../s1 |
| InChIKey | JSFKBMXEKZWHSF-QDDWCWDGSA-N |
| XLogP | 2.76 |
| TPSA | 137.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |