C20H24FN5O4 — CID 155878059
[(3aR,8aS)-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(5-methoxypyrazin-2-yl)methanone;formic acid (PubChem CID 155878059) has the molecular formula C20H24FN5O4 and a molecular weight of 417.44 g/mol. Its IUPAC name is [(3aR,8aS)-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(5-methoxypyrazin-2-yl)methanone;formic acid.
| Compound Name | [(3aR,8aS)-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(5-methoxypyrazin-2-yl)methanone;formic acid |
|---|---|
| PubChem CID | 155878059 |
| Molecular Formula | C20H24FN5O4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [(3aR,8aS)-6-(3-fluoro-2-pyridinyl)-1,3,3a,4,5,7,8,8a-octahydropyrrolo[3,4-d]azepin-2-yl]-(5-methoxypyrazin-2-yl)methanone;formic acid |
| SMILES | COc1cnc(C(=O)N2C[C@H]3CCN(c4ncccc4F)CC[C@H]3C2)cn1.O=CO |
| InChI | InChI=1S/C19H22FN5O2.CH2O2/c1-27-17-10-22-16(9-23-17)19(26)25-11-13-4-7-24(8-5-14(13)12-25)18-15(20)3-2-6-21-18;2-1-3/h2-3,6,9-10,13-14H,4-5,7-8,11-12H2,1H3;1H,(H,2,3)/t13-,14+; |
| InChIKey | CZXXZHMKKCMZNT-KAECKJJSSA-N |
| XLogP | 1.71 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|